Products 2452341-47-6

CAS 2452341-47-6 is the registry number for 6-(Morpholin-4-yl)pyridine-2-carboxylic acid hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

6-morpholin-4-ylpyridine-2-carboxylic acid;hydrochloride (CAS 2452341-47-6) is a chemical compound with the molecular formula C10H13ClN2O3 and a molecular weight of 244.67 g/mol. IUPAC name: 6-morpholin-4-ylpyridine-2-carboxylic acid;hydrochloride. InChIKey: CTSSZYOPDYMCJX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClN2O3
Molecular weight244.67 g/mol
IUPAC name6-morpholin-4-ylpyridine-2-carboxylic acid;hydrochloride
InChIKeyCTSSZYOPDYMCJX-UHFFFAOYSA-N
SMILESC1COCCN1C2=CC=CC(=N2)C(=O)O.Cl

Computed by PubChem (NCBI)