Products 138910-39-1
CAS 138910-39-1 appears in our catalog under these names: 3-[(4-Aminophenyl)formamido]propanoic acid hydrochloride, 95%, 3-(4-Aminobenzamido)propanoic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
3-[(4-aminobenzoyl)amino]propanoic acid;hydrochloride (CAS 138910-39-1) is a chemical compound with the molecular formula C10H13ClN2O3 and a molecular weight of 244.67 g/mol. IUPAC name: 3-[(4-aminobenzoyl)amino]propanoic acid;hydrochloride. InChIKey: NPAWBSVVLUEDHW-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O3 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 3-[(4-aminobenzoyl)amino]propanoic acid;hydrochloride |
| InChIKey | NPAWBSVVLUEDHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NCCC(=O)O)N.Cl |
Computed by PubChem (NCBI)