Products 59025-45-5

CAS 59025-45-5 is the registry number for 2-Morpholinonicotinic acid hydrochloride, 98+%. Offered by: Chemat Brand. Available pack sizes: on request.

2-morpholin-4-ylpyridine-3-carboxylic acid;hydrochloride (CAS 59025-45-5) is a chemical compound with the molecular formula C10H13ClN2O3 and a molecular weight of 244.67 g/mol. IUPAC name: 2-morpholin-4-ylpyridine-3-carboxylic acid;hydrochloride. InChIKey: ONFPOWGABHTBHA-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClN2O3
Molecular weight244.67 g/mol
IUPAC name2-morpholin-4-ylpyridine-3-carboxylic acid;hydrochloride
InChIKeyONFPOWGABHTBHA-UHFFFAOYSA-N
SMILESC1COCCN1C2=C(C=CC=N2)C(=O)O.Cl

Computed by PubChem (NCBI)