Products 1911650-68-4

CAS 1911650-68-4 is the registry number for (2-Chloro-pyrimidin-5-yloxy)-acetic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 2-(2-chloropyrimidin-5-yl)oxyacetate (CAS 1911650-68-4) is a chemical compound with the molecular formula C10H13ClN2O3 and a molecular weight of 244.67 g/mol. IUPAC name: tert-butyl 2-(2-chloropyrimidin-5-yl)oxyacetate. InChIKey: IJTPYKRLQSNGKV-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13ClN2O3
Molecular weight244.67 g/mol
IUPAC nametert-butyl 2-(2-chloropyrimidin-5-yl)oxyacetate
InChIKeyIJTPYKRLQSNGKV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)COC1=CN=C(N=C1)Cl

Computed by PubChem (NCBI)