cas: 1824065-43-1 — see every product listed under this CAS number, including other names
7-Methoxy-8-nitro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95+% (CAS 1824065-43-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A287983-1g |
| cas | 1824065-43-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 15680.98 Pln | |
| AmBeed | 5g | 29501.71 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-methoxy-8-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1824065-43-1) is a chemical compound with the molecular formula C10H13ClN2O3 and a molecular weight of 244.67 g/mol. IUPAC name: 7-methoxy-8-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: ACDHPWGAVLQVFU-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2O3 |
|---|---|
| Molecular weight | 244.67 g/mol |
| IUPAC name | 7-methoxy-8-nitro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | ACDHPWGAVLQVFU-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CCNC2)C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)