cas: 109151-82-8 — see every product listed under this CAS number, including other names
7-Nitro-2H-imidazo[4,5-d]pyridine, 95%, 95% (CAS 109151-82-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148YX-100mg |
| cas | 109151-82-8 |
| size | 100mg |
| availability | 0.15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 256.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
7-nitro-1H-imidazo[4,5-b]pyridine (CAS 109151-82-8) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 7-nitro-1H-imidazo[4,5-b]pyridine. InChIKey: GKNVWOWIFVSUFJ-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 7-nitro-1H-imidazo[4,5-b]pyridine |
| InChIKey | GKNVWOWIFVSUFJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1[N+](=O)[O-])NC=N2 |
Computed by PubChem (NCBI)