cas: 109151-82-8 — see every product listed under this CAS number, including other names
7-Nitro-3H-imidazo(4,5-b)pyridine, 97% (CAS 109151-82-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A2257407-10g |
| cas | 109151-82-8 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4744.18 Pln | |
| AmBeed | 5g | 2869.30 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-nitro-1H-imidazo[4,5-b]pyridine (CAS 109151-82-8) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 7-nitro-1H-imidazo[4,5-b]pyridine. InChIKey: GKNVWOWIFVSUFJ-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 7-nitro-1H-imidazo[4,5-b]pyridine |
| InChIKey | GKNVWOWIFVSUFJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C2C(=C1[N+](=O)[O-])NC=N2 |
Computed by PubChem (NCBI)