cas: 96334-46-2 — see every product listed under this CAS number, including other names
7-Oxo-4,5,6,7-tetrahydrobenzo(b)thiophene-3-carboxylic acid, 95+% (CAS 96334-46-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A111464-10g |
| cas | 96334-46-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 15303.40 Pln | |
| AmBeed | 5g | 10225.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylic acid (CAS 96334-46-2) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylic acid. InChIKey: DIHMRAKCRQYYNP-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| InChIKey | DIHMRAKCRQYYNP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)SC=C2C(=O)O |
Computed by PubChem (NCBI)