Products 1239955-68-0

CAS 1239955-68-0 is the registry number for 7-Oxo-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

7-oxo-5,6-dihydro-4H-1-benzothiophene-2-carboxylic acid (CAS 1239955-68-0) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 7-oxo-5,6-dihydro-4H-1-benzothiophene-2-carboxylic acid. InChIKey: DUFOMETVDHTDAB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8O3S
Molecular weight196.22 g/mol
IUPAC name7-oxo-5,6-dihydro-4H-1-benzothiophene-2-carboxylic acid
InChIKeyDUFOMETVDHTDAB-UHFFFAOYSA-N
SMILESC1CC2=C(C(=O)C1)SC(=C2)C(=O)O

Computed by PubChem (NCBI)