CAS 1239955-68-0 is the registry number for 7-Oxo-4,5,6,7-tetrahydrobenzo[b]thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-oxo-5,6-dihydro-4H-1-benzothiophene-2-carboxylic acid (CAS 1239955-68-0) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 7-oxo-5,6-dihydro-4H-1-benzothiophene-2-carboxylic acid. InChIKey: DUFOMETVDHTDAB-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 7-oxo-5,6-dihydro-4H-1-benzothiophene-2-carboxylic acid |
| InChIKey | DUFOMETVDHTDAB-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)SC(=C2)C(=O)O |
Computed by PubChem (NCBI)