CAS 134996-50-2 appears in our catalog under these names: Benzothiophene sulfone-2-methanol, Benzothiophene sulfone-2-methanol, 97%. Offered by: Chemat, Combi-blocks. Available pack sizes: 100mg, 500mg, 1g.
(1,1-dioxo-1-benzothiophen-2-yl)methanol (CAS 134996-50-2) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: (1,1-dioxo-1-benzothiophen-2-yl)methanol. InChIKey: GMPSGLSPNPTTHT-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | (1,1-dioxo-1-benzothiophen-2-yl)methanol |
| InChIKey | GMPSGLSPNPTTHT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(S2(=O)=O)CO |
Computed by PubChem (NCBI)