CAS 96334-46-2 appears in our catalog under these names: 7-Oxo-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylic acid, 95%, 7-Oxo-4,5,6,7-tetrahydrobenzo(b)thiophene-3-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 10g, 5g.
7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylic acid (CAS 96334-46-2) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylic acid. InChIKey: DIHMRAKCRQYYNP-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 7-oxo-5,6-dihydro-4H-1-benzothiophene-3-carboxylic acid |
| InChIKey | DIHMRAKCRQYYNP-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)SC=C2C(=O)O |
Computed by PubChem (NCBI)