CAS 16957-79-2 appears in our catalog under these names: 2-methyl-2,3-dihydro-1lambda6-benzothiophene-1,1,3-trione, 95%, 2-​Methyl-benzo(b)​thiophen-​3(2H)​-​one 1,​1-​dioxide, 2-Methylbenzo[b]thiophen-3(2H)-one 1,1-dioxide 95%, 2-methyl-2,3-dihydro-1lambda6-benzothiophene-1,1,3-trione, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 50mg, 0,5g, 25mg, 100mg, 1g, 5g.
2-methyl-1,1-dioxo-1-benzothiophen-3-one (CAS 16957-79-2) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 2-methyl-1,1-dioxo-1-benzothiophen-3-one. InChIKey: MQLDRFDZRIIXAS-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-1-benzothiophen-3-one |
| InChIKey | MQLDRFDZRIIXAS-UHFFFAOYSA-N |
| SMILES | CC1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)