CAS 19446-96-9 appears in our catalog under these names: 1,1-Dioxo-1lambda6-thiochroman-4-one, 95%, Thiochromanone 1,1–dioxide, 3,4-dihydro-2H-1-benzothiopyran-1,1,4-trione. Offered by: Combi-blocks, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 2,5g.
1,1-dioxo-2,3-dihydrothiochromen-4-one (CAS 19446-96-9) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydrothiochromen-4-one. InChIKey: NNJAUTBXMFSABH-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydrothiochromen-4-one |
| InChIKey | NNJAUTBXMFSABH-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)