cas: 2555-29-5 — see every product listed under this CAS number, including other names
8-Acetyl-7-hydroxy-4-methyl-2H-chromen-2-one 95% (CAS 2555-29-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A439589-250mg |
| cas | 2555-29-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 832.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A439589 |
8-acetyl-7-hydroxy-4-methylchromen-2-one (CAS 2555-29-5) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: 8-acetyl-7-hydroxy-4-methylchromen-2-one. InChIKey: WZOMQVFUPMLOGT-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 8-acetyl-7-hydroxy-4-methylchromen-2-one |
| InChIKey | WZOMQVFUPMLOGT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2C(=O)C)O |
Computed by PubChem (NCBI)