cas: 118-46-7 — see every product listed under this CAS number, including other names
8-Amino-2-naphthalenol, 95%, 95% (CAS 118-46-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187CM-1g |
| cas | 118-46-7 |
| size | 1g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 246.80 Pln | |
| Chemat | 50g | 424.40 Pln | |
| Chemat | 100g | 784.40 Pln | |
| Chemat | 250g | 1854.80 Pln | |
| Chemat | 500g | 3705.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
8-aminonaphthalen-2-ol (CAS 118-46-7) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 8-aminonaphthalen-2-ol. InChIKey: KVHHMYZBFBSVDI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 8-aminonaphthalen-2-ol |
| InChIKey | KVHHMYZBFBSVDI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)O)C(=C1)N |
Computed by PubChem (NCBI)