CAS 118-46-7 appears in our catalog under these names: 8-Amino-2-naphthol, 97%, 8-Amino-2-naphthol, 97% , 8-Amino-2-naphthol, 8-Amino-2-naphthol, >98.0%(HPLC), 8-Amino-2-naphthalenol, 95%, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Biosynth, TCI. Available pack sizes: 25g, 500g, 5g, 1g, 100g, 0,1kg, 0,05kg, 0,25kg.
8-aminonaphthalen-2-ol (CAS 118-46-7) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 8-aminonaphthalen-2-ol. InChIKey: KVHHMYZBFBSVDI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 8-aminonaphthalen-2-ol |
| InChIKey | KVHHMYZBFBSVDI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)O)C(=C1)N |
Computed by PubChem (NCBI)