8-Amino-2-naphthol, 99.41%
cas: 118-46-7 — see every product listed under this CAS number, including other names
8-Amino-2-naphthol, 99.41% (CAS 118-46-7) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-I0259-10 g |
| cas | 118-46-7 |
| size | 10 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 310.40 Pln | |
| MedChemExpress | 5 g | 240.74 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.41% |
8-aminonaphthalen-2-ol (CAS 118-46-7) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 8-aminonaphthalen-2-ol. InChIKey: KVHHMYZBFBSVDI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 8-aminonaphthalen-2-ol |
| InChIKey | KVHHMYZBFBSVDI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)O)C(=C1)N |
Computed by PubChem (NCBI)