cas: 118-46-7 — see every product listed under this CAS number, including other names
8-Amino-2-naphthol, 95% (CAS 118-46-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F104620-1G |
| cas | 118-46-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 133.30 Pln | |
| Fluorochem | 10g | 216.61 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 1237.08 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
8-aminonaphthalen-2-ol (CAS 118-46-7) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 8-aminonaphthalen-2-ol. InChIKey: KVHHMYZBFBSVDI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 8-aminonaphthalen-2-ol |
| InChIKey | KVHHMYZBFBSVDI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)O)C(=C1)N |
Computed by PubChem (NCBI)