8-Chloro-11-(piperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-3-ol, 95%
cas: 119410-08-1 — see every product listed under this CAS number, including other names
8-Chloro-11-(piperidin-4-ylidene)-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-3-ol, 95% (CAS 119410-08-1) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Chemat, BLDpharm.
| brand | Chemat |
|---|---|
| catalog number | Ch111IR3-10mg |
| cas | 119410-08-1 |
| size | 10mg |
| availability | 0.5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 10mg | 808.40 Pln | |
| Chemat | 25mg | 1547.60 Pln | |
| Chemat | 50mg | 2584.40 Pln | |
| Chemat | 100mg | 4346.00 Pln | |
| BLDpharm | 10mg | 1525.04 Pln | |
| BLDpharm | 25mg | 1819.38 Pln | |
| BLDpharm | 50mg | 2974.53 Pln | |
| BLDpharm | 100mg | 4929.40 Pln | |
| BLDpharm | 250mg | 10738.47 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-ol (CAS 119410-08-1) is a chemical compound with the molecular formula C19H19ClN2O and a molecular weight of 326.8 g/mol. IUPAC name: 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-ol. InChIKey: NDFMTPISBHBIKE-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2O |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-6-ol |
| InChIKey | NDFMTPISBHBIKE-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=C3CCNCC3)C4=C1C=C(C=C4)Cl)N=CC(=C2)O |
Computed by PubChem (NCBI)