CAS 349417-98-7 is the registry number for 1-(4-(3-chlorophenyl)piperazinyl)-3-phenylprop-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one (CAS 349417-98-7) is a chemical compound with the molecular formula C19H19ClN2O and a molecular weight of 326.8 g/mol. IUPAC name: (E)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one. InChIKey: ISQURPIWJSBIDR-MDZDMXLPSA-N.
| Molecular formula | C19H19ClN2O |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | (E)-1-[4-(3-chlorophenyl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
| InChIKey | ISQURPIWJSBIDR-MDZDMXLPSA-N |
| SMILES | C1CN(CCN1C2=CC(=CC=C2)Cl)C(=O)/C=C/C3=CC=CC=C3 |
Computed by PubChem (NCBI)