cas: 19685-84-8 — see every product listed under this CAS number, including other names
8-Chloro-2,3,4,5-Tetrahydro-1H-Pyrido[4,3-B]Indole, 95%, 95% (CAS 19685-84-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11J1Z5-100mg |
| cas | 19685-84-8 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 1g | 616.40 Pln | |
| Chemat | 5g | 1547.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole (CAS 19685-84-8) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: 8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole. InChIKey: LCKUBQBEDRQTRC-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | 8-chloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole |
| InChIKey | LCKUBQBEDRQTRC-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1NC3=C2C=C(C=C3)Cl |
Computed by PubChem (NCBI)