cas: 1936087-76-1 — see every product listed under this CAS number, including other names
8-Chloro-6-nitro-imidazo[1,2-a]pyridine, 95%+, 95%+ (CAS 1936087-76-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I3ZZ-100mg |
| cas | 1936087-76-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 544.40 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 500mg | 1163.60 Pln | |
| Chemat | 1g | 1706.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
8-chloro-6-nitroimidazo[1,2-a]pyridine (CAS 1936087-76-1) is a chemical compound with the molecular formula C7H4ClN3O2 and a molecular weight of 197.58 g/mol. IUPAC name: 8-chloro-6-nitroimidazo[1,2-a]pyridine. InChIKey: AUVYSHCOUJTHLK-UHFFFAOYSA-N.
| Molecular formula | C7H4ClN3O2 |
|---|---|
| Molecular weight | 197.58 g/mol |
| IUPAC name | 8-chloro-6-nitroimidazo[1,2-a]pyridine |
| InChIKey | AUVYSHCOUJTHLK-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(C=C(C2=N1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)