cas: 34006-16-1 — see every product listed under this CAS number, including other names
8-Mercaptoquinoline Hydrochloride [Extraction-spectrophotometric and fluorimetric reagent for soft metals], >95.0%(T) (CAS 34006-16-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A5004-1G |
| cas | 34006-16-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 472.39 Pln | |
| TCI | 5g | 1913.14 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(T) |
Quinoline-8-thiol;hydrochloride (CAS 34006-16-1) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: quinoline-8-thiol;hydrochloride. InChIKey: RWBSBQAUAJSGHY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | quinoline-8-thiol;hydrochloride |
| InChIKey | RWBSBQAUAJSGHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S)N=CC=C2.Cl |
Computed by PubChem (NCBI)