cas: 34006-16-1 — see every product listed under this CAS number, including other names
8-Mercaptoquinoline hydrochloride, 95% (CAS 34006-16-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QD-1905-5g |
| cas | 34006-16-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 1049.65 Pln | |
| Fluorochem | 25g | 3652.90 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Quinoline-8-thiol;hydrochloride (CAS 34006-16-1) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: quinoline-8-thiol;hydrochloride. InChIKey: RWBSBQAUAJSGHY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | quinoline-8-thiol;hydrochloride |
| InChIKey | RWBSBQAUAJSGHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S)N=CC=C2.Cl |
Computed by PubChem (NCBI)