cas: 34006-16-1 — see every product listed under this CAS number, including other names
8-Mercaptoquinoline Hydrochloride 95% (CAS 34006-16-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A550020-250mg |
| cas | 34006-16-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1410.56 Pln | |
| Ambeed | 25g | 4764.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A550020 |
Quinoline-8-thiol;hydrochloride (CAS 34006-16-1) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: quinoline-8-thiol;hydrochloride. InChIKey: RWBSBQAUAJSGHY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | quinoline-8-thiol;hydrochloride |
| InChIKey | RWBSBQAUAJSGHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S)N=CC=C2.Cl |
Computed by PubChem (NCBI)