cas: 34006-16-1 — see every product listed under this CAS number, including other names
8-Mercaptoquinoline Hydrochloride, 95%, 95% (CAS 34006-16-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145ER-100mg |
| cas | 34006-16-1 |
| size | 100mg |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 650.00 Pln | |
| Chemat | 25g | 2219.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Quinoline-8-thiol;hydrochloride (CAS 34006-16-1) is a chemical compound with the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. IUPAC name: quinoline-8-thiol;hydrochloride. InChIKey: RWBSBQAUAJSGHY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNS |
|---|---|
| Molecular weight | 197.69 g/mol |
| IUPAC name | quinoline-8-thiol;hydrochloride |
| InChIKey | RWBSBQAUAJSGHY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S)N=CC=C2.Cl |
Computed by PubChem (NCBI)