cas: 29377-72-8 — see every product listed under this CAS number, including other names
9-Methyl-9H-carbazole-3,6-dicarbaldehyde, 95%, 95% (CAS 29377-72-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BJ2M-50mg |
| cas | 29377-72-8 |
| size | 50mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 981.20 Pln | |
| Chemat | 100mg | 1624.40 Pln | |
| Chemat | 250mg | 2714.00 Pln | |
| Chemat | 1g | 7226.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
9-methylcarbazole-3,6-dicarbaldehyde (CAS 29377-72-8) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 9-methylcarbazole-3,6-dicarbaldehyde. InChIKey: ADDBIFUIFFYIQN-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 9-methylcarbazole-3,6-dicarbaldehyde |
| InChIKey | ADDBIFUIFFYIQN-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C=O)C3=C1C=CC(=C3)C=O |
Computed by PubChem (NCBI)