Products 59603-58-6

CAS 59603-58-6 is the registry number for 2-Phenyl-indolizine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-phenylindolizine-6-carboxylic acid (CAS 59603-58-6) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 2-phenylindolizine-6-carboxylic acid. InChIKey: SDKMZQLLHDLPGL-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO2
Molecular weight237.25 g/mol
IUPAC name2-phenylindolizine-6-carboxylic acid
InChIKeySDKMZQLLHDLPGL-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CN3C=C(C=CC3=C2)C(=O)O

Computed by PubChem (NCBI)