CAS 442562-80-3 is the registry number for 3-(1H-Indol-4-yl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-(1H-indol-4-yl)benzoic acid (CAS 442562-80-3) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 3-(1H-indol-4-yl)benzoic acid. InChIKey: JIDDTZCMXFNWAB-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 3-(1H-indol-4-yl)benzoic acid |
| InChIKey | JIDDTZCMXFNWAB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=C3C=CNC3=CC=C2 |
Computed by PubChem (NCBI)