CAS 886363-16-2 is the registry number for 3-(1H-Indol-5-yl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-(1H-indol-5-yl)benzoic acid (CAS 886363-16-2) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 3-(1H-indol-5-yl)benzoic acid. InChIKey: VKHHKQSCGXEKEE-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 3-(1H-indol-5-yl)benzoic acid |
| InChIKey | VKHHKQSCGXEKEE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=CC3=C(C=C2)NC=C3 |
Computed by PubChem (NCBI)