Products 886363-16-2

CAS 886363-16-2 is the registry number for 3-(1H-Indol-5-yl)benzoic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

3-(1H-indol-5-yl)benzoic acid (CAS 886363-16-2) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 3-(1H-indol-5-yl)benzoic acid. InChIKey: VKHHKQSCGXEKEE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H11NO2
Molecular weight237.25 g/mol
IUPAC name3-(1H-indol-5-yl)benzoic acid
InChIKeyVKHHKQSCGXEKEE-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)C(=O)O)C2=CC3=C(C=C2)NC=C3

Computed by PubChem (NCBI)