CAS 1445322-53-1 is the registry number for 4-(3-Formyl-5-methoxyphenyl)benzonitrile, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-(3-formyl-5-methoxyphenyl)benzonitrile (CAS 1445322-53-1) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 4-(3-formyl-5-methoxyphenyl)benzonitrile. InChIKey: LVXFKBMXLFGVKJ-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 4-(3-formyl-5-methoxyphenyl)benzonitrile |
| InChIKey | LVXFKBMXLFGVKJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)C2=CC=C(C=C2)C#N)C=O |
Computed by PubChem (NCBI)