Products 832735-87-2
CAS 832735-87-2 appears in our catalog under these names: 2-Phenylindolizine-1-carboxylic acid, 97%, 2-Phenyl-indolizine-1-carboxylic acid, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-phenylindolizine-1-carboxylic acid (CAS 832735-87-2) is a chemical compound with the molecular formula C15H11NO2 and a molecular weight of 237.25 g/mol. IUPAC name: 2-phenylindolizine-1-carboxylic acid. InChIKey: PWIPFORPXLATRU-UHFFFAOYSA-N.
| Molecular formula | C15H11NO2 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 2-phenylindolizine-1-carboxylic acid |
| InChIKey | PWIPFORPXLATRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN3C=CC=CC3=C2C(=O)O |
Computed by PubChem (NCBI)