CAS 4906-68-7 appears in our catalog under these names: AKR1C1-IN-1/ 98.62% (existing batch purity), 3–bromo–5–phenyl Salicylic Acid, AKR1C1 Inhibitor, 5-PBSA, AKR1C1-IN-1 98%, AKR1C1 Inhibitor, 5-PBSA 1PC X 25MG. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
3-bromo-2-hydroxy-5-phenylbenzoic acid (CAS 4906-68-7) is a chemical compound with the molecular formula C13H9BrO3 and a molecular weight of 293.11 g/mol. IUPAC name: 3-bromo-2-hydroxy-5-phenylbenzoic acid. InChIKey: XVZSXNULHSIRCQ-UHFFFAOYSA-N.
| Molecular formula | C13H9BrO3 |
|---|---|
| Molecular weight | 293.11 g/mol |
| IUPAC name | 3-bromo-2-hydroxy-5-phenylbenzoic acid |
| InChIKey | XVZSXNULHSIRCQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2)Br)O)C(=O)O |
Computed by PubChem (NCBI)