Products 80306-38-3
CAS 80306-38-3 appears in our catalog under these names: AR7/ 99.52% (existing batch purity), AR7, AR 7, AR7 99%, AR 7, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
7-chloro-3-(4-methylphenyl)-2H-1,4-benzoxazine (CAS 80306-38-3) is a chemical compound with the molecular formula C15H12ClNO and a molecular weight of 257.71 g/mol. IUPAC name: 7-chloro-3-(4-methylphenyl)-2H-1,4-benzoxazine. InChIKey: MVOZLTFXYGHZPM-UHFFFAOYSA-N.
| Molecular formula | C15H12ClNO |
|---|---|
| Molecular weight | 257.71 g/mol |
| IUPAC name | 7-chloro-3-(4-methylphenyl)-2H-1,4-benzoxazine |
| InChIKey | MVOZLTFXYGHZPM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)Cl)OC2 |
Computed by PubChem (NCBI)