Ac-Met-OMe, 97%
cas: 35671-83-1 — see every product listed under this CAS number, including other names
Ac-Met-OMe, 97% (CAS 35671-83-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A149010-250mg |
| cas | 35671-83-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 459.38 Pln | |
| Ambeed | 25g | 871.00 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 181.07 Pln | |
| BLDpharm | 5g | 453.20 Pln | |
| BLDpharm | 25g | 930.81 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 213.20 Pln | |
| Chemat | 10g | 357.20 Pln | |
| Chemat | 25g | 674.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Methyl (2S)-2-acetamido-4-methylsulfanylbutanoate (CAS 35671-83-1) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: methyl (2S)-2-acetamido-4-methylsulfanylbutanoate. InChIKey: YVMKSJIMTATAAS-ZETCQYMHSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | methyl (2S)-2-acetamido-4-methylsulfanylbutanoate |
| InChIKey | YVMKSJIMTATAAS-ZETCQYMHSA-N |
| SMILES | CC(=O)N[C@@H](CCSC)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
AC-MET-OME, N-Acetyl-L-methionine methyl ester, Acetyl-L-methionine methyl ester, methyl n-acetylmethioninate, methyl (2S)-2-acetamido-4-methylsulfanylbutanoate, L-Methionine, N-acetyl-, methyl ester, Methyl acetyl-L-methioninate, Methyl 2-(acetylamino)-4-(methylsulfanyl)butanoate #, YVMKSJIMTATAA, YVMKSJIMTATAAS-ZETCQYMHSA-N
