Products 7451-74-3

CAS 7451-74-3 is the registry number for N-Acetyl Methionine Methyl Ester, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg.

Structural formula: {0} (CAS {1})

Methyl 2-acetamido-4-methylsulfanylbutanoate (CAS 7451-74-3) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: methyl 2-acetamido-4-methylsulfanylbutanoate. InChIKey: YVMKSJIMTATAAS-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15NO3S
Molecular weight205.28 g/mol
IUPAC namemethyl 2-acetamido-4-methylsulfanylbutanoate
InChIKeyYVMKSJIMTATAAS-UHFFFAOYSA-N
SMILESCC(=O)NC(CCSC)C(=O)OC

Computed by PubChem (NCBI)