CAS 1864543-48-5 is the registry number for 3-(((1-Hydroxycyclobutyl)methyl)amino)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[[(1,1-dioxothietan-3-yl)amino]methyl]cyclobutan-1-ol (CAS 1864543-48-5) is a chemical compound with the molecular formula C8H15NO3S and a molecular weight of 205.28 g/mol. IUPAC name: 1-[[(1,1-dioxothietan-3-yl)amino]methyl]cyclobutan-1-ol. InChIKey: IPUOILRAFCOBJO-UHFFFAOYSA-N.
| Molecular formula | C8H15NO3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 1-[[(1,1-dioxothietan-3-yl)amino]methyl]cyclobutan-1-ol |
| InChIKey | IPUOILRAFCOBJO-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(CNC2CS(=O)(=O)C2)O |
Computed by PubChem (NCBI)