CAS 6018-52-6 appears in our catalog under these names: Acetylcytisine/ 99.98% (existing batch purity), N-Acetylcytisine. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 20mg, 10 mg, 5 mg.
(1R,9S)-11-acetyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (CAS 6018-52-6) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: (1R,9S)-11-acetyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one. InChIKey: WCRIKJOQMRFVPX-WDEREUQCSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | (1R,9S)-11-acetyl-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| InChIKey | WCRIKJOQMRFVPX-WDEREUQCSA-N |
| SMILES | CC(=O)N1C[C@@H]2C[C@H](C1)C3=CC=CC(=O)N3C2 |
Computed by PubChem (NCBI)