cas: 332927-03-4 — see every product listed under this CAS number, including other names
Acridine-9-carboxylic acid hydrate, 97% (CAS 332927-03-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 400220010 |
| cas | 332927-03-4 |
| size | 1g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1g | 306.02 Pln | |
| Thermo Scientific (Acros) | 5g | 935.43 Pln | |
| Thermo Scientific (Acros) | 25g | 3140.39 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
Acridine-9-carboxylic acid;hydrate (CAS 332927-03-4) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: acridine-9-carboxylic acid;hydrate. InChIKey: ZQAZWHSZYVXGMP-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | acridine-9-carboxylic acid;hydrate |
| InChIKey | ZQAZWHSZYVXGMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3C=CC=CC3=N2)C(=O)O.O |
Computed by PubChem (NCBI)