cas: 330970-70-2 — see every product listed under this CAS number, including other names
Alloc-Val-Ala-OH 95% (CAS 330970-70-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1162463-100mg |
| cas | 330970-70-2 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 515.00 Pln | |
| Ambeed | 10g | 893.25 Pln | |
| Ambeed | 25g | 1872.25 Pln | |
| Ambeed | 100g | 7273.44 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1162463 |
(2S)-2-[[(2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]propanoic acid (CAS 330970-70-2) is a chemical compound with the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. IUPAC name: (2S)-2-[[(2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]propanoic acid. InChIKey: LOIWGNGKOQWZSA-IUCAKERBSA-N.
| Molecular formula | C12H20N2O5 |
|---|---|
| Molecular weight | 272.30 g/mol |
| IUPAC name | (2S)-2-[[(2S)-3-methyl-2-(prop-2-enoxycarbonylamino)butanoyl]amino]propanoic acid |
| InChIKey | LOIWGNGKOQWZSA-IUCAKERBSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](C(C)C)NC(=O)OCC=C |
Computed by PubChem (NCBI)