cas: 481-72-1 — see every product listed under this CAS number, including other names
Aloe emodin 97% (CAS 481-72-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142364-250mg |
| cas | 481-72-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 5g | 331.44 Pln | |
| Ambeed | 25g | 882.12 Pln | |
| Ambeed | 100g | 2767.81 Pln | |
| Ambeed | 500g | 10861.25 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142364 |
Aloe emodin is a dihydroxyanthraquinone that is chrysazin carrying a hydroxymethyl group at position 3. It has been isolated from plant species of the genus Aloe. It has a role as an antineoplastic agent and a plant metabolite. It is an aromatic primary alcohol and a dihydroxyanthraquinone. It is functionally related to a chrysazin.
Source: ChEBI
| Molecular formula | C15H10O5 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | 1,8-dihydroxy-3-(hydroxymethyl)anthracene-9,10-dione |
| InChIKey | YDQWDHRMZQUTBA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)CO |
Computed by PubChem (NCBI)