cas: 13159-88-1 — see every product listed under this CAS number, including other names
Alpha-(2-thiazolylamino)-o-cresol, 95%, 95% (CAS 13159-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111ZGP-100mg |
| cas | 13159-88-1 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 242.00 Pln | |
| Chemat | 1g | 578.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[(1,3-thiazol-2-ylamino)methyl]phenol (CAS 13159-88-1) is a chemical compound with the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. IUPAC name: 2-[(1,3-thiazol-2-ylamino)methyl]phenol. InChIKey: FUVLIIWCXQIRQM-UHFFFAOYSA-N.
| Molecular formula | C10H10N2OS |
|---|---|
| Molecular weight | 206.27 g/mol |
| IUPAC name | 2-[(1,3-thiazol-2-ylamino)methyl]phenol |
| InChIKey | FUVLIIWCXQIRQM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC2=NC=CS2)O |
Computed by PubChem (NCBI)