CAS 36052-37-6 appears in our catalog under these names: Alpinetin/ 99.61% (existing batch purity), 7-Hydroxy-5-methoxyflavanone, Alpinetin, >97.0%(HPLC)(T), Alpinetin 95%, Alpinetin, 95%, 95%. Offered by: TargetMol, Biosynth, TCI, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1mg, 1g.
(2S)-7-hydroxy-5-methoxy-2-phenyl-2,3-dihydrochromen-4-one (CAS 36052-37-6) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: (2S)-7-hydroxy-5-methoxy-2-phenyl-2,3-dihydrochromen-4-one. InChIKey: QQQCWVDPMPFUGF-ZDUSSCGKSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | (2S)-7-hydroxy-5-methoxy-2-phenyl-2,3-dihydrochromen-4-one |
| InChIKey | QQQCWVDPMPFUGF-ZDUSSCGKSA-N |
| SMILES | COC1=CC(=CC2=C1C(=O)C[C@H](O2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)