CAS 86989-18-6 appears in our catalog under these names: Alpinumisoflavone acetate/ 98%, Alpinumisoflavone acetate. Offered by: TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 1 mg, 5 mg.
[4-(5-hydroxy-2,2-dimethyl-6-oxopyrano[3,2-g]chromen-7-yl)phenyl] acetate (CAS 86989-18-6) is a chemical compound with the molecular formula C22H18O6 and a molecular weight of 378.4 g/mol. IUPAC name: [4-(5-hydroxy-2,2-dimethyl-6-oxopyrano[3,2-g]chromen-7-yl)phenyl] acetate. InChIKey: UGAJYYNANGVRBF-UHFFFAOYSA-N.
| Molecular formula | C22H18O6 |
|---|---|
| Molecular weight | 378.4 g/mol |
| IUPAC name | [4-(5-hydroxy-2,2-dimethyl-6-oxopyrano[3,2-g]chromen-7-yl)phenyl] acetate |
| InChIKey | UGAJYYNANGVRBF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2=COC3=CC4=C(C=CC(O4)(C)C)C(=C3C2=O)O |
Computed by PubChem (NCBI)