CAS 19819-18-2 appears in our catalog under these names: CL–300619, Antiproliferative agent-15/ 98.29% (existing batch purity), 5,6,7,8-Tetrahydro-2-phenyl[1]benzothieno[2,3-d]pyrimidin-4(1H)-one, 97%, 97%, Antiproliferative agent-15, 99.18%, 5-phenyl-8-thia-4,6-diazatricyclo[7.4.0.0²,â·]trideca-1(9),2(7),4-trien-3-one, 98%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 25mg, 5mg, 1mg, 10mg, 50mg, 100 mg.
2-phenyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (CAS 19819-18-2) is a chemical compound with the molecular formula C16H14N2OS and a molecular weight of 282.4 g/mol. IUPAC name: 2-phenyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one. InChIKey: CDFWRIZOSNAGCV-UHFFFAOYSA-N.
| Molecular formula | C16H14N2OS |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 2-phenyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| InChIKey | CDFWRIZOSNAGCV-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(S2)N=C(NC3=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)