CAS 321913-54-6 appears in our catalog under these names: Etoricoxib Impurity 42, Etoricoxib Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6-methyl-3-pyridinyl)-2-(4-methylsulfanylphenyl)-3-oxopropanenitrile (CAS 321913-54-6) is a chemical compound with the molecular formula C16H14N2OS and a molecular weight of 282.4 g/mol. IUPAC name: 3-(6-methyl-3-pyridinyl)-2-(4-methylsulfanylphenyl)-3-oxopropanenitrile. InChIKey: OBCGEALAAFPYBA-UHFFFAOYSA-N.
| Molecular formula | C16H14N2OS |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 3-(6-methyl-3-pyridinyl)-2-(4-methylsulfanylphenyl)-3-oxopropanenitrile |
| InChIKey | OBCGEALAAFPYBA-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C(=O)C(C#N)C2=CC=C(C=C2)SC |
Computed by PubChem (NCBI)