CAS 749151-25-5 is the registry number for 2-(4-Aminophenyl)-4-(4-methoxyphenyl)thiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]aniline (CAS 749151-25-5) is a chemical compound with the molecular formula C16H14N2OS and a molecular weight of 282.4 g/mol. IUPAC name: 4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]aniline. InChIKey: FEJBCMDICNNALW-UHFFFAOYSA-N.
| Molecular formula | C16H14N2OS |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 4-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]aniline |
| InChIKey | FEJBCMDICNNALW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CSC(=N2)C3=CC=C(C=C3)N |
Computed by PubChem (NCBI)