Products 2504202-24-6
CAS 2504202-24-6 is the registry number for 3-Benzyloxy-5-thiophen-2-yl-pyridin-2-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-phenylmethoxy-5-thiophen-2-ylpyridin-2-amine (CAS 2504202-24-6) is a chemical compound with the molecular formula C16H14N2OS and a molecular weight of 282.4 g/mol. IUPAC name: 3-phenylmethoxy-5-thiophen-2-ylpyridin-2-amine. InChIKey: VVFZXUHNTOOSEK-UHFFFAOYSA-N.
| Molecular formula | C16H14N2OS |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 3-phenylmethoxy-5-thiophen-2-ylpyridin-2-amine |
| InChIKey | VVFZXUHNTOOSEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(N=CC(=C2)C3=CC=CS3)N |
Computed by PubChem (NCBI)