CAS 1325304-88-8 is the registry number for 2-(4-Methoxyphenyl)-4-phenyl-1h-imidazole-5-thiol, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-(4-methoxyphenyl)-5-phenyl-1H-imidazole-4-thiol (CAS 1325304-88-8) is a chemical compound with the molecular formula C16H14N2OS and a molecular weight of 282.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5-phenyl-1H-imidazole-4-thiol. InChIKey: PMQLOFNNWCITMP-UHFFFAOYSA-N.
| Molecular formula | C16H14N2OS |
|---|---|
| Molecular weight | 282.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5-phenyl-1H-imidazole-4-thiol |
| InChIKey | PMQLOFNNWCITMP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=C(N2)C3=CC=CC=C3)S |
Computed by PubChem (NCBI)