cas: 57907-49-0 — see every product listed under this CAS number, including other names
BENZO[B]THIOPHENE-2-CARBOXYLIC ACID, 6-AMINO-, METHYL ESTER, 97% (CAS 57907-49-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F534799-100MG |
| cas | 57907-49-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 518.59 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 1903.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 6-amino-1-benzothiophene-2-carboxylate (CAS 57907-49-0) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: methyl 6-amino-1-benzothiophene-2-carboxylate. InChIKey: XIUHYFQAAXIVBY-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | methyl 6-amino-1-benzothiophene-2-carboxylate |
| InChIKey | XIUHYFQAAXIVBY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=C(C=C2)N |
Computed by PubChem (NCBI)